C14H19NO2 — CID 102303088
(4aS,8aR)-4-acetyl-2,6,7-trimethyl-4a,5,8,8a-tetrahydroisoquinolin-1-one (PubChem CID 102303088) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4aS,8aR)-4-acetyl-2,6,7-trimethyl-4a,5,8,8a-tetrahydroisoquinolin-1-one.
| Compound Name | (4aS,8aR)-4-acetyl-2,6,7-trimethyl-4a,5,8,8a-tetrahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 102303088 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4aS,8aR)-4-acetyl-2,6,7-trimethyl-4a,5,8,8a-tetrahydroisoquinolin-1-one |
| SMILES | CC(=O)C1=CN(C)C(=O)[C@@H]2CC(C)=C(C)C[C@H]12 |
| InChI | InChI=1S/C14H19NO2/c1-8-5-11-12(6-9(8)2)14(17)15(4)7-13(11)10(3)16/h7,11-12H,5-6H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | SKOAKVHKVUGDTA-NWDGAFQWSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|