C13H18O3 — CID 102303113
1-[(3'aR,7'aR)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-5'-yl]ethanone (PubChem CID 102303113) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-[(3'aR,7'aR)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-5'-yl]ethanone.
| Compound Name | 1-[(3'aR,7'aR)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-5'-yl]ethanone |
|---|---|
| PubChem CID | 102303113 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-[(3'aR,7'aR)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-5'-yl]ethanone |
| SMILES | CC(=O)C1=CC[C@@H]2[C@H](CCC23OCCO3)C1 |
| InChI | InChI=1S/C13H18O3/c1-9(14)10-2-3-12-11(8-10)4-5-13(12)15-6-7-16-13/h2,11-12H,3-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | QULUPNDAJVGVBY-VXGBXAGGSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |