About dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate
dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate (PubChem CID 102303206) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate |
| PubChem CID | 102303206 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C(/C)CCC=C(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H26O4/c1-7-12-18(16(19)21-5,17(20)22-6)13-11-15(4)10-8-9-14(2)3/h1,9,11H,8,10,12-13H2,2-6H3/b15-11- |
| InChIKey | NGYVBPDFGMBNHG-PTNGSMBKSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate?
The IUPAC name of dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate (CID 102303206) is dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate.
What is the SMILES notation for dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate?
The canonical SMILES for dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate is C#CCC(C/C=C(/C)CCC=C(C)C)(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate?
The InChIKey is NGYVBPDFGMBNHG-PTNGSMBKSA-N. The full InChI is InChI=1S/C18H26O4/c1-7-12-18(16(19)21-5,17(20)22-6)13-11-15(4)10-8-9-14(2)3/h1,9,11H,8,10,12-13H2,2-6H3/b15-11-.
What are the key properties of dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate?
dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate has a molecular weight of 306.40 g/mol, XLogP of 3.42, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate is sourced from PubChem (CID 102303206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).