C16H20N2O6 — CID 102303925
(1R,3S)-1-[(2R,3R)-1,2,3,4-tetrahydroxybutyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 102303925) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (1R,3S)-1-[(2R,3R)-1,2,3,4-tetrahydroxybutyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1R,3S)-1-[(2R,3R)-1,2,3,4-tetrahydroxybutyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 102303925 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1R,3S)-1-[(2R,3R)-1,2,3,4-tetrahydroxybutyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H](C(O)[C@@H](O)[C@H](O)CO)N1 |
| InChI | InChI=1S/C16H20N2O6/c19-6-11(20)14(21)15(22)13-12-8(5-10(18-13)16(23)24)7-3-1-2-4-9(7)17-12/h1-4,10-11,13-15,17-22H,5-6H2,(H,23,24)/t10-,11+,13+,14-,15?/m0/s1 |
| InChIKey | UZQRKFVRIVGGRI-YFOCSUALSA-N |
| XLogP | -1.12 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|