C22H20B2N2O6 — CID 102304694
N-[2-(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine (PubChem CID 102304694) has the molecular formula C22H20B2N2O6 and a molecular weight of 430.03 g/mol. Its IUPAC name is N-[2-(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine.
| Compound Name | N-[2-(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine |
|---|---|
| PubChem CID | 102304694 |
| Molecular Formula | C22H20B2N2O6 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[2-(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine |
| SMILES | CC(CN(Cc1ccc([N+](=O)[O-])cc1)B1Oc2ccccc2O1)B1Oc2ccccc2O1 |
| InChI | InChI=1S/C22H20B2N2O6/c1-16(23-29-19-6-2-3-7-20(19)30-23)14-25(15-17-10-12-18(13-11-17)26(27)28)24-31-21-8-4-5-9-22(21)32-24/h2-13,16H,14-15H2,1H3 |
| InChIKey | CWJNJHNVFVXTNH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|