C28H23B3N2O8 — CID 102304695
N-[3,3-bis(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine (PubChem CID 102304695) has the molecular formula C28H23B3N2O8 and a molecular weight of 547.93 g/mol. Its IUPAC name is N-[3,3-bis(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine.
| Compound Name | N-[3,3-bis(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine |
|---|---|
| PubChem CID | 102304695 |
| Molecular Formula | C28H23B3N2O8 |
| Molecular Weight | 547.93 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | N-[3,3-bis(1,3,2-benzodioxaborol-2-yl)propyl]-N-[(4-nitrophenyl)methyl]-1,3,2-benzodioxaborol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(CN(CCC(B2Oc3ccccc3O2)B2Oc3ccccc3O2)B2Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/C28H23B3N2O8/c34-33(35)21-15-13-20(14-16-21)19-32(31-40-26-11-5-6-12-27(26)41-31)18-17-28(29-36-22-7-1-2-8-23(22)37-29)30-38-24-9-3-4-10-25(24)39-30/h1-16,28H,17-19H2 |
| InChIKey | NRYQSJLZZXJKBG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|