C21H20N2O3 — CID 102304810
3-amino-4-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 102304810) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-amino-4-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102304810 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-amino-4-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(N2CCC[C@H]2C(O)(c2ccccc2)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C21H20N2O3/c22-17-18(20(25)19(17)24)23-13-7-12-16(23)21(26,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,26H,7,12-13,22H2/t16-/m0/s1 |
| InChIKey | BBHGFQPMWOHMLC-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|