C33H28F2N2O3 — CID 10230544
2-[4-[bis(3-fluorophenyl)methoxy]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid (PubChem CID 10230544) has the molecular formula C33H28F2N2O3 and a molecular weight of 538.59 g/mol. Its IUPAC name is 2-[4-[bis(3-fluorophenyl)methoxy]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[4-[bis(3-fluorophenyl)methoxy]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10230544 |
| Molecular Formula | C33H28F2N2O3 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[4-[bis(3-fluorophenyl)methoxy]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(OC(c3cccc(F)c3)c3cccc(F)c3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C33H28F2N2O3/c34-25-8-4-6-22(18-25)31(23-7-5-9-26(35)19-23)40-28-15-12-21(13-16-28)32-36-29-20-24(33(38)39)14-17-30(29)37(32)27-10-2-1-3-11-27/h4-9,12-20,27,31H,1-3,10-11H2,(H,38,39) |
| InChIKey | RNWUCRWMKUMFMS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |