C34H38N2O4 — CID 10230558
2-[3-[3-[(2,4-dimethoxyphenyl)methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide (PubChem CID 10230558) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-[3-[3-[(2,4-dimethoxyphenyl)methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[(2,4-dimethoxyphenyl)methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10230558 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 2-[3-[3-[(2,4-dimethoxyphenyl)methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide |
| SMILES | COc1ccc(CN(CCCOc2cccc(CC(N)=O)c2)CC(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C34H38N2O4/c1-38-30-18-17-29(33(23-30)39-2)24-36(19-10-20-40-31-16-9-11-26(21-31)22-34(35)37)25-32(27-12-5-3-6-13-27)28-14-7-4-8-15-28/h3-9,11-18,21,23,32H,10,19-20,22,24-25H2,1-2H3,(H2,35,37) |
| InChIKey | XMZKYVTYJKSJKG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|