C20H36O4Si — CID 102306213
(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxymethyl)-5,6-dimethyl-2-prop-2-enylcyclohex-2-en-1-one (PubChem CID 102306213) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxymethyl)-5,6-dimethyl-2-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxymethyl)-5,6-dimethyl-2-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102306213 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxymethyl)-5,6-dimethyl-2-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CCC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@](C)(COCOC)C1=O |
| InChI | InChI=1S/C20H36O4Si/c1-10-11-16-12-17(24-25(8,9)19(3,4)5)15(2)20(6,18(16)21)13-23-14-22-7/h10,12,15,17H,1,11,13-14H2,2-9H3/t15-,17+,20-/m0/s1 |
| InChIKey | STGPAVQFPIOEOS-VPWXQRGCSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|