C21H38O6Si — CID 102306214
(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethyl)-6-(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 102306214) has the molecular formula C21H38O6Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethyl)-6-(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethyl)-6-(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102306214 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethyl)-6-(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | COCOC[C@]1(C)C(=O)C(CC2OCCO2)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C21H38O6Si/c1-15-17(27-28(7,8)20(2,3)4)11-16(12-18-25-9-10-26-18)19(22)21(15,5)13-24-14-23-6/h11,15,17-18H,9-10,12-14H2,1-8H3/t15-,17+,21-/m0/s1 |
| InChIKey | RDTOORKXDLWAQQ-XPIZARPCSA-N |
| XLogP | 3.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|