C14H22O6 — CID 102306556
(2S)-3-methyl-3-(2,4,5-trimethoxyphenoxy)butane-1,2-diol (PubChem CID 102306556) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (2S)-3-methyl-3-(2,4,5-trimethoxyphenoxy)butane-1,2-diol.
| Compound Name | (2S)-3-methyl-3-(2,4,5-trimethoxyphenoxy)butane-1,2-diol |
|---|---|
| PubChem CID | 102306556 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2S)-3-methyl-3-(2,4,5-trimethoxyphenoxy)butane-1,2-diol |
| SMILES | COc1cc(OC)c(OC(C)(C)[C@@H](O)CO)cc1OC |
| InChI | InChI=1S/C14H22O6/c1-14(2,13(16)8-15)20-12-7-10(18-4)9(17-3)6-11(12)19-5/h6-7,13,15-16H,8H2,1-5H3/t13-/m0/s1 |
| InChIKey | SYFKIEROFSVLAH-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |