C25H21N3O — CID 102306605
19-(3-methylbut-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one (PubChem CID 102306605) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 19-(3-methylbut-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one.
| Compound Name | 19-(3-methylbut-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
|---|---|
| PubChem CID | 102306605 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 19-(3-methylbut-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
| SMILES | CC(C)=CCc1ccc2[nH]c3c4[nH]c5ccccc5c4c4c(c3c2c1)CNC4=O |
| InChI | InChI=1S/C25H21N3O/c1-13(2)7-8-14-9-10-19-16(11-14)20-17-12-26-25(29)22(17)21-15-5-3-4-6-18(15)27-24(21)23(20)28-19/h3-7,9-11,27-28H,8,12H2,1-2H3,(H,26,29) |
| InChIKey | MDUXVBJOGCUUQR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|