About N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide
N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide (PubChem CID 102306857) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide.
Molecular Properties
| Compound Name | N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide |
| PubChem CID | 102306857 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide |
| SMILES | COCCN(C)C(=O)C(=O)N(C)CCOC |
| InChI | InChI=1S/C10H20N2O4/c1-11(5-7-15-3)9(13)10(14)12(2)6-8-16-4/h5-8H2,1-4H3 |
| InChIKey | VPYYTLSJCGSVKP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide?
The IUPAC name of N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide (CID 102306857) is N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide.
What is the SMILES notation for N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide?
The canonical SMILES for N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide is COCCN(C)C(=O)C(=O)N(C)CCOC.
What is the InChIKey of N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide?
The InChIKey is VPYYTLSJCGSVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-11(5-7-15-3)9(13)10(14)12(2)6-8-16-4/h5-8H2,1-4H3.
What are the key properties of N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide?
N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide has a molecular weight of 232.28 g/mol, XLogP of -0.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-methoxyethyl)-N,N'-dimethyloxamide is sourced from PubChem (CID 102306857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).