About (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione
(4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione (PubChem CID 102306879) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione.
Molecular Properties
| Compound Name | (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione |
| PubChem CID | 102306879 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione |
| SMILES | C=C1C(=O)N[C@@]2(CCOC2=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H13NO3/c1-9-11(10-5-3-2-4-6-10)14(15-12(9)16)7-8-18-13(14)17/h2-6,11H,1,7-8H2,(H,15,16)/t11-,14-/m0/s1 |
| InChIKey | UILFTVBTSWVWOA-FZMZJTMJSA-N |
| XLogP | 1.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione?
The IUPAC name of (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione (CID 102306879) is (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione.
What is the SMILES notation for (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione?
The canonical SMILES for (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione is C=C1C(=O)N[C@@]2(CCOC2=O)[C@@H]1c1ccccc1.
What is the InChIKey of (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione?
The InChIKey is UILFTVBTSWVWOA-FZMZJTMJSA-N. The full InChI is InChI=1S/C14H13NO3/c1-9-11(10-5-3-2-4-6-10)14(15-12(9)16)7-8-18-13(14)17/h2-6,11H,1,7-8H2,(H,15,16)/t11-,14-/m0/s1.
What are the key properties of (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione?
(4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione has a molecular weight of 243.26 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-3-methylidene-4-phenyl-7-oxa-1-azaspiro[4.4]nonane-2,6-dione is sourced from PubChem (CID 102306879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).