C8H14O6 — CID 102307677
(1R,3R,4R,5S,6S,7R)-3-methoxy-2-oxabicyclo[2.2.2]octane-4,5,6,7-tetrol (PubChem CID 102307677) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is (1R,3R,4R,5S,6S,7R)-3-methoxy-2-oxabicyclo[2.2.2]octane-4,5,6,7-tetrol.
| Compound Name | (1R,3R,4R,5S,6S,7R)-3-methoxy-2-oxabicyclo[2.2.2]octane-4,5,6,7-tetrol |
|---|---|
| PubChem CID | 102307677 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (1R,3R,4R,5S,6S,7R)-3-methoxy-2-oxabicyclo[2.2.2]octane-4,5,6,7-tetrol |
| SMILES | CO[C@@H]1O[C@H]2[C@@H](O)[C@H](O)[C@]1(O)C[C@H]2O |
| InChI | InChI=1S/C8H14O6/c1-13-7-8(12)2-3(9)5(14-7)4(10)6(8)11/h3-7,9-12H,2H2,1H3/t3-,4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | VZFBVMQZGZKJAW-CVBHLRHXSA-N |
| XLogP | -2.42 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |