About diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate
diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate (PubChem CID 102307777) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate |
| PubChem CID | 102307777 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate |
| SMILES | C=C(C/C=C(\C)CCC=C(C)C)CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H32O4/c1-7-23-19(21)18(20(22)24-8-2)14-17(6)13-12-16(5)11-9-10-15(3)4/h10,12,18H,6-9,11,13-14H2,1-5H3/b16-12+ |
| InChIKey | RSJVFFFUBSUBPP-FOWTUZBSSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate?
The IUPAC name of diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate (CID 102307777) is diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate.
What is the SMILES notation for diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate?
The canonical SMILES for diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate is C=C(C/C=C(\C)CCC=C(C)C)CC(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate?
The InChIKey is RSJVFFFUBSUBPP-FOWTUZBSSA-N. The full InChI is InChI=1S/C20H32O4/c1-7-23-19(21)18(20(22)24-8-2)14-17(6)13-12-16(5)11-9-10-15(3)4/h10,12,18H,6-9,11,13-14H2,1-5H3/b16-12+.
What are the key properties of diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate?
diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate has a molecular weight of 336.47 g/mol, XLogP of 4.76, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(4E)-5,9-dimethyl-2-methylidenedeca-4,8-dienyl]propanedioate is sourced from PubChem (CID 102307777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).