C22H32O6 — CID 102307947
dimethyl (3E,5E,7R,8R,11Z)-8-methoxy-3,7,11-trimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate (PubChem CID 102307947) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is dimethyl (3E,5E,7R,8R,11Z)-8-methoxy-3,7,11-trimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,5E,7R,8R,11Z)-8-methoxy-3,7,11-trimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102307947 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | dimethyl (3E,5E,7R,8R,11Z)-8-methoxy-3,7,11-trimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(=O)/C=C(/C)CC[C@@H](OC)[C@H](C)/C=C/C=C(\C)C1 |
| InChI | InChI=1S/C22H32O6/c1-15-10-11-19(26-4)17(3)9-7-8-16(2)13-22(20(24)27-5,21(25)28-6)14-18(23)12-15/h7-9,12,17,19H,10-11,13-14H2,1-6H3/b9-7+,15-12-,16-8+/t17-,19-/m1/s1 |
| InChIKey | KCORPYHZSLGRFA-ZLVFINJFSA-N |
| XLogP | 3.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|