About 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole]
5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] (PubChem CID 102308031) has the molecular formula C16H16O2Se
and a molecular weight of 319.26 g/mol. Its IUPAC name is 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole].
Molecular Properties
| Compound Name | 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] |
| PubChem CID | 102308031 |
| Molecular Formula | C16H16O2Se |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] |
| SMILES | Cc1ccc2c(c1)CO[Se]21OCc2cc(C)ccc21 |
| InChI | InChI=1S/C16H16O2Se/c1-11-3-5-15-13(7-11)9-17-19(15)16-6-4-12(2)8-14(16)10-18-19/h3-8H,9-10H2,1-2H3 |
| InChIKey | GINKASYTKFIPGB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole]?
The IUPAC name of 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] (CID 102308031) is 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole].
What is the SMILES notation for 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole]?
The canonical SMILES for 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] is Cc1ccc2c(c1)CO[Se]21OCc2cc(C)ccc21.
What is the InChIKey of 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole]?
The InChIKey is GINKASYTKFIPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2Se/c1-11-3-5-15-13(7-11)9-17-19(15)16-6-4-12(2)8-14(16)10-18-19/h3-8H,9-10H2,1-2H3.
What are the key properties of 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole]?
5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] has a molecular weight of 319.26 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5'-dimethyl-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] is sourced from PubChem (CID 102308031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).