C33H22N4O2 — CID 102308208
3-(4,6-diphenoxy-1,3,5-triazin-2-yl)-9-phenylcarbazole (PubChem CID 102308208) has the molecular formula C33H22N4O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 3-(4,6-diphenoxy-1,3,5-triazin-2-yl)-9-phenylcarbazole.
| Compound Name | 3-(4,6-diphenoxy-1,3,5-triazin-2-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 102308208 |
| Molecular Formula | C33H22N4O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 3-(4,6-diphenoxy-1,3,5-triazin-2-yl)-9-phenylcarbazole |
| SMILES | c1ccc(Oc2nc(Oc3ccccc3)nc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C33H22N4O2/c1-4-12-24(13-5-1)37-29-19-11-10-18-27(29)28-22-23(20-21-30(28)37)31-34-32(38-25-14-6-2-7-15-25)36-33(35-31)39-26-16-8-3-9-17-26/h1-22H |
| InChIKey | TYGWINLVLIQARY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |