C29H38N8O3 — CID 10230834
tert-butyl 4-[4-[[7-(cyclohexylcarbamoylamino)pyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 10230834) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is tert-butyl 4-[4-[[7-(cyclohexylcarbamoylamino)pyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[7-(cyclohexylcarbamoylamino)pyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10230834 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | tert-butyl 4-[4-[[7-(cyclohexylcarbamoylamino)pyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3ncc4ccc(NC(=O)NC5CCCCC5)nc4n3)cc2)CC1 |
| InChI | InChI=1S/C29H38N8O3/c1-29(2,3)40-28(39)37-17-15-36(16-18-37)23-12-10-22(11-13-23)31-26-30-19-20-9-14-24(33-25(20)35-26)34-27(38)32-21-7-5-4-6-8-21/h9-14,19,21H,4-8,15-18H2,1-3H3,(H3,30,31,32,33,34,35,38) |
| InChIKey | QYODGURZVDETMS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|