C34H32Br2O2 — CID 102308472
4-[2,7-dibromo-9-(4-octoxyphenyl)fluoren-9-yl]benzaldehyde (PubChem CID 102308472) has the molecular formula C34H32Br2O2 and a molecular weight of 632.44 g/mol. Its IUPAC name is 4-[2,7-dibromo-9-(4-octoxyphenyl)fluoren-9-yl]benzaldehyde.
| Compound Name | 4-[2,7-dibromo-9-(4-octoxyphenyl)fluoren-9-yl]benzaldehyde |
|---|---|
| PubChem CID | 102308472 |
| Molecular Formula | C34H32Br2O2 |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | 4-[2,7-dibromo-9-(4-octoxyphenyl)fluoren-9-yl]benzaldehyde |
| SMILES | CCCCCCCCOc1ccc(C2(c3ccc(C=O)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C34H32Br2O2/c1-2-3-4-5-6-7-20-38-29-16-12-26(13-17-29)34(25-10-8-24(23-37)9-11-25)32-21-27(35)14-18-30(32)31-19-15-28(36)22-33(31)34/h8-19,21-23H,2-7,20H2,1H3 |
| InChIKey | WRYHJUNLOZCAAF-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|