C14H10F3NO3 — CID 102308505
N-[2-(1,4-dioxonaphthalen-2-yl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 102308505) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is N-[2-(1,4-dioxonaphthalen-2-yl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(1,4-dioxonaphthalen-2-yl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102308505 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[2-(1,4-dioxonaphthalen-2-yl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C=C(CCNC(=O)C(F)(F)F)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H10F3NO3/c15-14(16,17)13(21)18-6-5-8-7-11(19)9-3-1-2-4-10(9)12(8)20/h1-4,7H,5-6H2,(H,18,21) |
| InChIKey | AFXSZGQLCLRIQM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|