C19H15N3O — CID 102309094
1-benzyl-7-methylpyrimido[4,5-b]quinolin-4-one (PubChem CID 102309094) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-benzyl-7-methylpyrimido[4,5-b]quinolin-4-one.
| Compound Name | 1-benzyl-7-methylpyrimido[4,5-b]quinolin-4-one |
|---|---|
| PubChem CID | 102309094 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-benzyl-7-methylpyrimido[4,5-b]quinolin-4-one |
| SMILES | Cc1ccc2nc3c(cc2c1)c(=O)ncn3Cc1ccccc1 |
| InChI | InChI=1S/C19H15N3O/c1-13-7-8-17-15(9-13)10-16-18(21-17)22(12-20-19(16)23)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3 |
| InChIKey | ONNHQUWSAOJNLD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|