C27H46O2Si — CID 102309219
(1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,12-trimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one (PubChem CID 102309219) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,12-trimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one.
| Compound Name | (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,12-trimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one |
|---|---|
| PubChem CID | 102309219 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,12-trimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one |
| SMILES | C=C1C[C@]23[C@@H](CC[C@H]4[C@@](C)(CO[Si](C)(C)C(C)(C)C)CCC[C@@]42C)CC(C)C(=O)[C@@H]13 |
| InChI | InChI=1S/C27H46O2Si/c1-18-15-20-11-12-21-25(6,17-29-30(8,9)24(3,4)5)13-10-14-26(21,7)27(20)16-19(2)22(27)23(18)28/h18,20-22H,2,10-17H2,1,3-9H3/t18?,20-,21-,22+,25+,26-,27+/m0/s1 |
| InChIKey | MIHDUJKAJLWHOZ-HEVAWBRXSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|