C21H18ClF9N4O — CID 10230931
(2R)-4-(3-chloro-2-pyridinyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]phenyl]-2-methylpiperazine-1-carboxamide (PubChem CID 10230931) has the molecular formula C21H18ClF9N4O and a molecular weight of 548.84 g/mol. Its IUPAC name is (2R)-4-(3-chloro-2-pyridinyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]phenyl]-2-methylpiperazine-1-carboxamide.
| Compound Name | (2R)-4-(3-chloro-2-pyridinyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]phenyl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 10230931 |
| Molecular Formula | C21H18ClF9N4O |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | (2R)-4-(3-chloro-2-pyridinyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]phenyl]-2-methylpiperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2ncccc2Cl)CCN1C(=O)Nc1ccc(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18ClF9N4O/c1-12-11-34(16-15(22)3-2-8-32-16)9-10-35(12)17(36)33-14-6-4-13(5-7-14)18(19(23,24)25,20(26,27)28)21(29,30)31/h2-8,12H,9-11H2,1H3,(H,33,36)/t12-/m1/s1 |
| InChIKey | IIMZXOFFDDLGBT-GFCCVEGCSA-N |
| XLogP | 6.40 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |