C12H27B3O6 — CID 102309481
2,4,6-tri(butan-2-yloxy)-1,3,5,2,4,6-trioxatriborinane (PubChem CID 102309481) has the molecular formula C12H27B3O6 and a molecular weight of 299.78 g/mol. Its IUPAC name is 2,4,6-tri(butan-2-yloxy)-1,3,5,2,4,6-trioxatriborinane.
| Compound Name | 2,4,6-tri(butan-2-yloxy)-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| PubChem CID | 102309481 |
| Molecular Formula | C12H27B3O6 |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2,4,6-tri(butan-2-yloxy)-1,3,5,2,4,6-trioxatriborinane |
| SMILES | CCC(C)OB1OB(OC(C)CC)OB(OC(C)CC)O1 |
| InChI | InChI=1S/C12H27B3O6/c1-7-10(4)16-13-19-14(17-11(5)8-2)21-15(20-13)18-12(6)9-3/h10-12H,7-9H2,1-6H3 |
| InChIKey | SZEXMKXXYOJBIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|