C19H17F3O4 — CID 102309661
diethyl 5-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxylate (PubChem CID 102309661) has the molecular formula C19H17F3O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is diethyl 5-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102309661 |
| Molecular Formula | C19H17F3O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | diethyl 5-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H17F3O4/c1-3-25-17(23)14-9-13(10-15(11-14)18(24)26-4-2)12-5-7-16(8-6-12)19(20,21)22/h5-11H,3-4H2,1-2H3 |
| InChIKey | GBBZNCVHLJQXRU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |