C32H28O17 — CID 102309690
1,4,6,8-tetrahydroxy-2-[1,3,5-trihydroxy-9-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,8-tetrahydroxanthen-4-yl]xanthen-9-one (PubChem CID 102309690) has the molecular formula C32H28O17 and a molecular weight of 684.56 g/mol. Its IUPAC name is 1,4,6,8-tetrahydroxy-2-[1,3,5-trihydroxy-9-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,8-tetrahydroxanthen-4-yl]xanthen-9-one.
| Compound Name | 1,4,6,8-tetrahydroxy-2-[1,3,5-trihydroxy-9-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,8-tetrahydroxanthen-4-yl]xanthen-9-one |
|---|---|
| PubChem CID | 102309690 |
| Molecular Formula | C32H28O17 |
| Molecular Weight | 684.56 g/mol |
| Exact Mass | 684.13 |
| IUPAC Name | 1,4,6,8-tetrahydroxy-2-[1,3,5-trihydroxy-9-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,8-tetrahydroxanthen-4-yl]xanthen-9-one |
| SMILES | O=c1c2c(oc3c(-c4cc(O)c5oc6cc(O)cc(O)c6c(=O)c5c4O)c(O)cc(O)c13)C(O)CCC2O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C32H28O17/c33-7-17-24(41)27(44)28(45)32(48-17)47-15-2-1-10(35)29-21(15)26(43)20-13(38)6-12(37)18(31(20)49-29)9-5-14(39)30-22(23(9)40)25(42)19-11(36)3-8(34)4-16(19)46-30/h3-6,10,15,17,24,27-28,32-41,44-45H,1-2,7H2/t10?,15?,17-,24-,27+,28-,32-/m1/s1 |
| InChIKey | DVMVOSIIRBPMIY-RFXMQKANSA-N |
| XLogP | 0.64 |
| TPSA | 301.41 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.56 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|