C28H42N2O9 — CID 10230994
2-methylpropyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate (PubChem CID 10230994) has the molecular formula C28H42N2O9 and a molecular weight of 550.65 g/mol. Its IUPAC name is 2-methylpropyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate.
| Compound Name | 2-methylpropyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 10230994 |
| Molecular Formula | C28H42N2O9 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-methylpropyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
| SMILES | Cc1c(Cc2ccc(OC(C)C)cc2)c(O[C@@H]2O[C@H](COC(=O)OCC(C)C)[C@@H](O)[C@H](O)[C@H]2O)nn1C(C)C |
| InChI | InChI=1S/C28H42N2O9/c1-15(2)13-35-28(34)36-14-22-23(31)24(32)25(33)27(38-22)39-26-21(18(7)30(29-26)16(3)4)12-19-8-10-20(11-9-19)37-17(5)6/h8-11,15-17,22-25,27,31-33H,12-14H2,1-7H3/t22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | AQMKUOARLRRLCK-NUPXYHBHSA-N |
| XLogP | 3.15 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |