C10H11ClO — CID 102310526
[(1S,2R,3S)-2-chloro-3-phenylcyclopropyl]methanol (PubChem CID 102310526) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is [(1S,2R,3S)-2-chloro-3-phenylcyclopropyl]methanol.
| Compound Name | [(1S,2R,3S)-2-chloro-3-phenylcyclopropyl]methanol |
|---|---|
| PubChem CID | 102310526 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | [(1S,2R,3S)-2-chloro-3-phenylcyclopropyl]methanol |
| SMILES | OC[C@H]1[C@H](Cl)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H11ClO/c11-10-8(6-12)9(10)7-4-2-1-3-5-7/h1-5,8-10,12H,6H2/t8-,9-,10+/m1/s1 |
| InChIKey | IUIOHHMUYIAGBX-BBBLOLIVSA-N |
| XLogP | 2.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|