C13H20O5 — CID 102310979
(2R,4R)-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione (PubChem CID 102310979) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2R,4R)-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione.
| Compound Name | (2R,4R)-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione |
|---|---|
| PubChem CID | 102310979 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2R,4R)-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione |
| SMILES | CC(C)[C@H]1C[C@@H](C)OC12C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C13H20O5/c1-7(2)9-6-8(3)16-13(9)10(14)17-12(4,5)18-11(13)15/h7-9H,6H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | BCZUAMXMPJDODP-RKDXNWHRSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|