C25H25F4N3O7 — CID 10231144
(3S)-3-[[(2S)-2-[[2-(benzylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 10231144) has the molecular formula C25H25F4N3O7 and a molecular weight of 555.48 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-(benzylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-(benzylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 10231144 |
| Molecular Formula | C25H25F4N3O7 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-(benzylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(=O)NCc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H25F4N3O7/c1-12(2)21(32-25(38)24(37)30-10-13-6-4-3-5-7-13)23(36)31-16(9-18(34)35)17(33)11-39-22-19(28)14(26)8-15(27)20(22)29/h3-8,12,16,21H,9-11H2,1-2H3,(H,30,37)(H,31,36)(H,32,38)(H,34,35)/t16-,21-/m0/s1 |
| InChIKey | PKQPMQYJGPSJFR-KKSFZXQISA-N |
| XLogP | 1.61 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|