About 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine
10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine (PubChem CID 102311758) has the molecular formula C33H22N4O
and a molecular weight of 490.57 g/mol. Its IUPAC name is 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine |
| PubChem CID | 102311758 |
| Molecular Formula | C33H22N4O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N4c5ccccc5Oc5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C33H22N4O/c1-3-11-23(12-4-1)31-34-32(24-13-5-2-6-14-24)36-33(35-31)25-19-21-26(22-20-25)37-27-15-7-9-17-29(27)38-30-18-10-8-16-28(30)37/h1-22H |
| InChIKey | ZABORCXHTNWZRV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine?
The IUPAC name of 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine (CID 102311758) is 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine.
What is the SMILES notation for 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine?
The canonical SMILES for 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine is c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N4c5ccccc5Oc5ccccc54)cc3)n2)cc1.
What is the InChIKey of 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine?
The InChIKey is ZABORCXHTNWZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22N4O/c1-3-11-23(12-4-1)31-34-32(24-13-5-2-6-14-24)36-33(35-31)25-19-21-26(22-20-25)37-27-15-7-9-17-29(27)38-30-18-10-8-16-28(30)37/h1-22H.
What are the key properties of 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine?
10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine has a molecular weight of 490.57 g/mol, XLogP of 8.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoxazine is sourced from PubChem (CID 102311758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).