C40H44Si4 — CID 102311843
trimethyl-[2-[10,13,20-tris(2-trimethylsilylethynyl)-3-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaenyl]ethynyl]silane (PubChem CID 102311843) has the molecular formula C40H44Si4 and a molecular weight of 637.14 g/mol. Its IUPAC name is trimethyl-[2-[10,13,20-tris(2-trimethylsilylethynyl)-3-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[10,13,20-tris(2-trimethylsilylethynyl)-3-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 102311843 |
| Molecular Formula | C40H44Si4 |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | trimethyl-[2-[10,13,20-tris(2-trimethylsilylethynyl)-3-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1c2c(c(C#C[Si](C)(C)C)c3ccccc13)-c1c-2c(C#C[Si](C)(C)C)c2ccccc2c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C40H44Si4/c1-41(2,3)25-21-33-29-17-13-14-18-30(29)34(22-26-42(4,5)6)38-37(33)39-35(23-27-43(7,8)9)31-19-15-16-20-32(31)36(40(38)39)24-28-44(10,11)12/h13-20H,1-12H3 |
| InChIKey | ZNRQTKTYSGFWQA-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|