C20H28O3 — CID 102312007
(3'R,3'aR,10'aS)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,6,7,8,10a-hexahydro-2H-benzo[f]azulene]-10'-one (PubChem CID 102312007) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3'R,3'aR,10'aS)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,6,7,8,10a-hexahydro-2H-benzo[f]azulene]-10'-one.
| Compound Name | (3'R,3'aR,10'aS)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,6,7,8,10a-hexahydro-2H-benzo[f]azulene]-10'-one |
|---|---|
| PubChem CID | 102312007 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3'R,3'aR,10'aS)-3'a-methyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-3,4,6,7,8,10a-hexahydro-2H-benzo[f]azulene]-10'-one |
| SMILES | CC(C)[C@H]1CC2(OCCO2)[C@@H]2C(=O)C3=CCCCC3=CC[C@]12C |
| InChI | InChI=1S/C20H28O3/c1-13(2)16-12-20(22-10-11-23-20)18-17(21)15-7-5-4-6-14(15)8-9-19(16,18)3/h7-8,13,16,18H,4-6,9-12H2,1-3H3/t16-,18-,19-/m1/s1 |
| InChIKey | LLBDCIWBAHXQDI-BHIYHBOVSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |