C24H37NO6Si — CID 102312152
1-O-benzyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropanoyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 102312152) has the molecular formula C24H37NO6Si and a molecular weight of 463.65 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropanoyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropanoyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102312152 |
| Molecular Formula | C24H37NO6Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropanoyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C(=O)C(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H37NO6Si/c1-17(2)20(26)24(21(27)29-6)14-19(31-32(7,8)23(3,4)5)15-25(24)22(28)30-16-18-12-10-9-11-13-18/h9-13,17,19H,14-16H2,1-8H3/t19-,24+/m1/s1 |
| InChIKey | CWMUBUIUBZRNPK-DVECYGJZSA-N |
| XLogP | 4.56 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|