C20H11F13Te — CID 102312188
[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-enyl]tellanylbenzene (PubChem CID 102312188) has the molecular formula C20H11F13Te and a molecular weight of 625.88 g/mol. Its IUPAC name is [(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-enyl]tellanylbenzene.
| Compound Name | [(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-enyl]tellanylbenzene |
|---|---|
| PubChem CID | 102312188 |
| Molecular Formula | C20H11F13Te |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 627.97 |
| IUPAC Name | [(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-enyl]tellanylbenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C=C(/[Te]c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H11F13Te/c21-15(22,16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33)11-14(12-7-3-1-4-8-12)34-13-9-5-2-6-10-13/h1-11H/b14-11+ |
| InChIKey | AIOPFMXREXMPDD-SDNWHVSQSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|