C21H30O3 — CID 102312262
3-(5-hydroxynonan-5-yl)-5-(2-methylprop-2-enoxy)bicyclo[4.2.0]octa-1(6),2,4-trien-7-one (PubChem CID 102312262) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-(5-hydroxynonan-5-yl)-5-(2-methylprop-2-enoxy)bicyclo[4.2.0]octa-1(6),2,4-trien-7-one.
| Compound Name | 3-(5-hydroxynonan-5-yl)-5-(2-methylprop-2-enoxy)bicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
|---|---|
| PubChem CID | 102312262 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-(5-hydroxynonan-5-yl)-5-(2-methylprop-2-enoxy)bicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
| SMILES | C=C(C)COc1cc(C(O)(CCCC)CCCC)cc2c1C(=O)C2 |
| InChI | InChI=1S/C21H30O3/c1-5-7-9-21(23,10-8-6-2)17-11-16-12-18(22)20(16)19(13-17)24-14-15(3)4/h11,13,23H,3,5-10,12,14H2,1-2,4H3 |
| InChIKey | RBAGQRHTMRSJCN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|