C30H27NO2 — CID 102312364
(1S,2R,6S,7R,10R)-1,8,9-trimethyl-4,7,10-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 102312364) has the molecular formula C30H27NO2 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1S,2R,6S,7R,10R)-1,8,9-trimethyl-4,7,10-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R,10R)-1,8,9-trimethyl-4,7,10-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 102312364 |
| Molecular Formula | C30H27NO2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (1S,2R,6S,7R,10R)-1,8,9-trimethyl-4,7,10-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C(C)[C@]2(c3ccccc3)[C@H](c3ccccc3)[C@@]1(C)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C30H27NO2/c1-19-20(2)30(22-15-9-5-10-16-22)25-24(29(19,3)26(30)21-13-7-4-8-14-21)27(32)31(28(25)33)23-17-11-6-12-18-23/h4-18,24-26H,1-3H3/t24-,25+,26+,29+,30+/m0/s1 |
| InChIKey | LFHPWTCVTXKUDT-XCFIRPTDSA-N |
| XLogP | 5.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|