C21H27N3O4 — CID 102312871
diethyl (Z)-2-[[(2S)-1-benzylpyrrolidin-2-yl]methylamino]-3-cyanobut-2-enedioate (PubChem CID 102312871) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is diethyl (Z)-2-[[(2S)-1-benzylpyrrolidin-2-yl]methylamino]-3-cyanobut-2-enedioate.
| Compound Name | diethyl (Z)-2-[[(2S)-1-benzylpyrrolidin-2-yl]methylamino]-3-cyanobut-2-enedioate |
|---|---|
| PubChem CID | 102312871 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | diethyl (Z)-2-[[(2S)-1-benzylpyrrolidin-2-yl]methylamino]-3-cyanobut-2-enedioate |
| SMILES | CCOC(=O)/C(C#N)=C(\NC[C@@H]1CCCN1Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C21H27N3O4/c1-3-27-20(25)18(13-22)19(21(26)28-4-2)23-14-17-11-8-12-24(17)15-16-9-6-5-7-10-16/h5-7,9-10,17,23H,3-4,8,11-12,14-15H2,1-2H3/b19-18-/t17-/m0/s1 |
| InChIKey | RDWDRDCEMCEAJE-NSURYPBFSA-N |
| XLogP | 2.14 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|