C29H44F3NO6 — CID 10231291
[8-[3-hydroxy-7-oxo-7-(propylamino)-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 10231291) has the molecular formula C29H44F3NO6 and a molecular weight of 559.67 g/mol. Its IUPAC name is [8-[3-hydroxy-7-oxo-7-(propylamino)-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[3-hydroxy-7-oxo-7-(propylamino)-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 10231291 |
| Molecular Formula | C29H44F3NO6 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | [8-[3-hydroxy-7-oxo-7-(propylamino)-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCCNC(=O)CC(CC(O)CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)CC)C21)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H44F3NO6/c1-6-12-33-25(35)16-22(38-28(37)29(30,31)32)15-21(34)10-11-23-19(5)8-9-20-13-17(3)14-24(26(20)23)39-27(36)18(4)7-2/h8-9,13,17-19,21-24,26,34H,6-7,10-12,14-16H2,1-5H3,(H,33,35) |
| InChIKey | YTSAZBNQOJSFSM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |