C22H31NO4 — CID 102313082
(2S,3aS,5S,6S,8Z,10aS)-5-ethyl-N,N-dimethyl-6-phenylmethoxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonine-2-carboxamide (PubChem CID 102313082) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (2S,3aS,5S,6S,8Z,10aS)-5-ethyl-N,N-dimethyl-6-phenylmethoxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonine-2-carboxamide.
| Compound Name | (2S,3aS,5S,6S,8Z,10aS)-5-ethyl-N,N-dimethyl-6-phenylmethoxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonine-2-carboxamide |
|---|---|
| PubChem CID | 102313082 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (2S,3aS,5S,6S,8Z,10aS)-5-ethyl-N,N-dimethyl-6-phenylmethoxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonine-2-carboxamide |
| SMILES | CC[C@@H]1O[C@H]2C[C@@H](C(=O)N(C)C)O[C@H]2C/C=C\C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c1-4-17-18(25-15-16-10-6-5-7-11-16)12-8-9-13-19-20(26-17)14-21(27-19)22(24)23(2)3/h5-11,17-21H,4,12-15H2,1-3H3/b9-8-/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | WUCYWWHSVOJEQQ-QRILPUDZSA-N |
| XLogP | 3.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|