C18H20O6 — CID 102313099
2-O-ethyl 4-O-methyl (2R,3S,4S)-5-oxo-3-phenyl-4-prop-2-enyloxolane-2,4-dicarboxylate (PubChem CID 102313099) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl (2R,3S,4S)-5-oxo-3-phenyl-4-prop-2-enyloxolane-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl (2R,3S,4S)-5-oxo-3-phenyl-4-prop-2-enyloxolane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102313099 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-O-ethyl 4-O-methyl (2R,3S,4S)-5-oxo-3-phenyl-4-prop-2-enyloxolane-2,4-dicarboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C(=O)O[C@@H](C(=O)OCC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20O6/c1-4-11-18(16(20)22-3)13(12-9-7-6-8-10-12)14(24-17(18)21)15(19)23-5-2/h4,6-10,13-14H,1,5,11H2,2-3H3/t13-,14-,18+/m1/s1 |
| InChIKey | JJHVMLMQMOCMQR-LBTNJELSSA-N |
| XLogP | 1.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|