C36H38O2 — CID 102313196
2-methyl-3-[(2E,6E,10E)-3,7,11-trimethyl-12-naphthalen-1-yldodeca-2,6,10-trienyl]naphthalene-1,4-dione (PubChem CID 102313196) has the molecular formula C36H38O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 2-methyl-3-[(2E,6E,10E)-3,7,11-trimethyl-12-naphthalen-1-yldodeca-2,6,10-trienyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[(2E,6E,10E)-3,7,11-trimethyl-12-naphthalen-1-yldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 102313196 |
| Molecular Formula | C36H38O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 2-methyl-3-[(2E,6E,10E)-3,7,11-trimethyl-12-naphthalen-1-yldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)Cc2cccc3ccccc23)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C36H38O2/c1-25(13-10-15-27(3)24-30-18-11-17-29-16-5-6-19-32(29)30)12-9-14-26(2)22-23-31-28(4)35(37)33-20-7-8-21-34(33)36(31)38/h5-8,11-12,15-22H,9-10,13-14,23-24H2,1-4H3/b25-12+,26-22+,27-15+ |
| InChIKey | IVYIVNAWUWHGEY-OXXVBBSTSA-N |
| XLogP | 9.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|