C33H40N2O6 — CID 10231322
[(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(2-oxo-2-pyridin-3-ylethyl)pyridine-3-carboxylate (PubChem CID 10231322) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(2-oxo-2-pyridin-3-ylethyl)pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(2-oxo-2-pyridin-3-ylethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10231322 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(2-oxo-2-pyridin-3-ylethyl)pyridine-3-carboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)c2cccn(CC(=O)c3cccnc3)c2=O)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C33H40N2O6/c1-6-31(4)17-26(32(5)20(2)11-13-33(21(3)28(31)38)14-12-24(36)27(32)33)41-30(40)23-10-8-16-35(29(23)39)19-25(37)22-9-7-15-34-18-22/h6-10,15-16,18,20-21,26-28,38H,1,11-14,17,19H2,2-5H3/t20-,21+,26-,27?,28+,31-,32+,33?/m1/s1 |
| InChIKey | RVGLZLNECKMYIY-QDIRGRKRSA-N |
| XLogP | 4.65 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|