C14H18F2N2O2 — CID 102313747
tert-butyl N-amino-N-(3,3-difluoro-2-phenylprop-2-enyl)carbamate (PubChem CID 102313747) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is tert-butyl N-amino-N-(3,3-difluoro-2-phenylprop-2-enyl)carbamate.
| Compound Name | tert-butyl N-amino-N-(3,3-difluoro-2-phenylprop-2-enyl)carbamate |
|---|---|
| PubChem CID | 102313747 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | tert-butyl N-amino-N-(3,3-difluoro-2-phenylprop-2-enyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)CC(=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-14(2,3)20-13(19)18(17)9-11(12(15)16)10-7-5-4-6-8-10/h4-8H,9,17H2,1-3H3 |
| InChIKey | RAEQKXRGIWBLKR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|