About tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate
tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate (PubChem CID 102314408) has the molecular formula C20H27NO2Si
and a molecular weight of 341.53 g/mol. Its IUPAC name is tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate |
| PubChem CID | 102314408 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H27NO2Si/c1-20(2,3)23-19(22)21-18(16-12-8-6-9-13-16)24(4,5)17-14-10-7-11-15-17/h6-15,18H,1-5H3,(H,21,22) |
| InChIKey | ALUDQDQYWVXWAX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate?
The IUPAC name of tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate (CID 102314408) is tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate.
What is the SMILES notation for tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate?
The canonical SMILES for tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate is CC(C)(C)OC(=O)NC(c1ccccc1)[Si](C)(C)c1ccccc1.
What is the InChIKey of tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate?
The InChIKey is ALUDQDQYWVXWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO2Si/c1-20(2,3)23-19(22)21-18(16-12-8-6-9-13-16)24(4,5)17-14-10-7-11-15-17/h6-15,18H,1-5H3,(H,21,22).
What are the key properties of tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate?
tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate has a molecular weight of 341.53 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[dimethyl(phenyl)silyl]-phenylmethyl]carbamate is sourced from PubChem (CID 102314408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).