C10H9ClF3NOS — CID 102314427
N-[4-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]acetamide (PubChem CID 102314427) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is N-[4-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]acetamide.
| Compound Name | N-[4-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 102314427 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | N-[4-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SC(Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9ClF3NOS/c1-6(16)15-7-2-4-8(5-3-7)17-9(11)10(12,13)14/h2-5,9H,1H3,(H,15,16) |
| InChIKey | AUVZFBZJEFPJPL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|