C15H29NO3Si — CID 102314449
(4R,5R)-5-[(2R)-but-3-en-2-yl]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-oxazolidin-2-one (PubChem CID 102314449) has the molecular formula C15H29NO3Si and a molecular weight of 299.49 g/mol. Its IUPAC name is (4R,5R)-5-[(2R)-but-3-en-2-yl]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-[(2R)-but-3-en-2-yl]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102314449 |
| Molecular Formula | C15H29NO3Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (4R,5R)-5-[(2R)-but-3-en-2-yl]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](C)[C@H]1OC(=O)N[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO3Si/c1-8-11(2)13-12(16-14(17)19-13)9-10-18-20(6,7)15(3,4)5/h8,11-13H,1,9-10H2,2-7H3,(H,16,17)/t11-,12-,13-/m1/s1 |
| InChIKey | MMYHUNQJWLJAFM-JHJVBQTASA-N |
| XLogP | 3.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|